C10H20N2 — CID 121321867
(7R)-2,5-diazabicyclo[5.5.0]dodecane (PubChem CID 121321867) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is (7R)-2,5-diazabicyclo[5.5.0]dodecane.
| Compound Name | (7R)-2,5-diazabicyclo[5.5.0]dodecane |
|---|---|
| PubChem CID | 121321867 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | (7R)-2,5-diazabicyclo[5.5.0]dodecane |
| SMILES | C1CCC2NCCNC[C@H]2CC1 |
| InChI | InChI=1S/C10H20N2/c1-2-4-9-8-11-6-7-12-10(9)5-3-1/h9-12H,1-8H2/t9-,10?/m1/s1 |
| InChIKey | PDCPOIQWLUOZCM-YHMJZVADSA-N |
| XLogP | 1.13 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |