About 1-butyl-3-methylthiourea
1-butyl-3-methylthiourea (PubChem CID 12666002) has the molecular formula C6H14N2S
and a molecular weight of 146.26 g/mol. Its IUPAC name is 1-butyl-3-methylthiourea.
Molecular Properties
| Compound Name | 1-butyl-3-methylthiourea |
| PubChem CID | 12666002 |
| Molecular Formula | C6H14N2S |
| Molecular Weight | 146.26 g/mol |
| Exact Mass | 146.09 |
| IUPAC Name | 1-butyl-3-methylthiourea |
| SMILES | CCCCNC(=S)NC |
| InChI | InChI=1S/C6H14N2S/c1-3-4-5-8-6(9)7-2/h3-5H2,1-2H3,(H2,7,8,9) |
| InChIKey | PBOQJGMFSBTLHQ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.26 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-3-methylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-3-methylthiourea?
The IUPAC name of 1-butyl-3-methylthiourea (CID 12666002) is 1-butyl-3-methylthiourea.
What is the SMILES notation for 1-butyl-3-methylthiourea?
The canonical SMILES for 1-butyl-3-methylthiourea is CCCCNC(=S)NC.
What is the InChIKey of 1-butyl-3-methylthiourea?
The InChIKey is PBOQJGMFSBTLHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2S/c1-3-4-5-8-6(9)7-2/h3-5H2,1-2H3,(H2,7,8,9).
What are the key properties of 1-butyl-3-methylthiourea?
1-butyl-3-methylthiourea has a molecular weight of 146.26 g/mol, XLogP of 0.88, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-3-methylthiourea is sourced from PubChem (CID 12666002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).