About N'-ethyl-N'-(3-methylbutan-2-yl)ethane-1,2-diamine
N'-ethyl-N'-(3-methylbutan-2-yl)ethane-1,2-diamine (PubChem CID 126661238) has the molecular formula C9H22N2
and a molecular weight of 158.29 g/mol. Its IUPAC name is N'-ethyl-N'-(3-methylbutan-2-yl)ethane-1,2-diamine.
Analyze N'-ethyl-N'-(3-methylbutan-2-yl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-ethyl-N'-(3-methylbutan-2-yl)ethane-1,2-diamine?
The IUPAC name of N'-ethyl-N'-(3-methylbutan-2-yl)ethane-1,2-diamine (CID 126661238) is N'-ethyl-N'-(3-methylbutan-2-yl)ethane-1,2-diamine.
What is the SMILES notation for N'-ethyl-N'-(3-methylbutan-2-yl)ethane-1,2-diamine?
The canonical SMILES for N'-ethyl-N'-(3-methylbutan-2-yl)ethane-1,2-diamine is CCN(CCN)C(C)C(C)C.
What is the InChIKey of N'-ethyl-N'-(3-methylbutan-2-yl)ethane-1,2-diamine?
The InChIKey is GWBDKYRUPXYDTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H22N2/c1-5-11(7-6-10)9(4)8(2)3/h8-9H,5-7,10H2,1-4H3.
What are the key properties of N'-ethyl-N'-(3-methylbutan-2-yl)ethane-1,2-diamine?
N'-ethyl-N'-(3-methylbutan-2-yl)ethane-1,2-diamine has a molecular weight of 158.29 g/mol, XLogP of 1.31, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-ethyl-N'-(3-methylbutan-2-yl)ethane-1,2-diamine is sourced from PubChem (CID 126661238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).