C16H18ClN3OS — CID 126661615
[5-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-ylsulfanyl)isoquinolin-4-yl] hypochlorite (PubChem CID 126661615) has the molecular formula C16H18ClN3OS and a molecular weight of 335.86 g/mol. Its IUPAC name is [5-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-ylsulfanyl)isoquinolin-4-yl] hypochlorite.
| Compound Name | [5-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-ylsulfanyl)isoquinolin-4-yl] hypochlorite |
|---|---|
| PubChem CID | 126661615 |
| Molecular Formula | C16H18ClN3OS |
| Molecular Weight | 335.86 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | [5-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-ylsulfanyl)isoquinolin-4-yl] hypochlorite |
| SMILES | ClOc1cncc2cccc(SN3CC4CCCNC4C3)c12 |
| InChI | InChI=1S/C16H18ClN3OS/c17-21-14-8-18-7-11-3-1-5-15(16(11)14)22-20-9-12-4-2-6-19-13(12)10-20/h1,3,5,7-8,12-13,19H,2,4,6,9-10H2 |
| InChIKey | LJJFNYXKUDNPMC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.86 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|