C33H55N3 — CID 126662046
(3Z,5Z)-7-methyl-N-[1-[4-[(2Z,4Z)-4-[2-[1-[(methylideneamino)methyl]piperidin-4-yl]ethyl]hexa-2,4-dienyl]cyclohex-3-en-1-yl]ethyl]nona-3,5-dien-1-amine (PubChem CID 126662046) has the molecular formula C33H55N3 and a molecular weight of 493.82 g/mol. Its IUPAC name is (3Z,5Z)-7-methyl-N-[1-[4-[(2Z,4Z)-4-[2-[1-[(methylideneamino)methyl]piperidin-4-yl]ethyl]hexa-2,4-dienyl]cyclohex-3-en-1-yl]ethyl]nona-3,5-dien-1-amine.
| Compound Name | (3Z,5Z)-7-methyl-N-[1-[4-[(2Z,4Z)-4-[2-[1-[(methylideneamino)methyl]piperidin-4-yl]ethyl]hexa-2,4-dienyl]cyclohex-3-en-1-yl]ethyl]nona-3,5-dien-1-amine |
|---|---|
| PubChem CID | 126662046 |
| Molecular Formula | C33H55N3 |
| Molecular Weight | 493.82 g/mol |
| Exact Mass | 493.44 |
| IUPAC Name | (3Z,5Z)-7-methyl-N-[1-[4-[(2Z,4Z)-4-[2-[1-[(methylideneamino)methyl]piperidin-4-yl]ethyl]hexa-2,4-dienyl]cyclohex-3-en-1-yl]ethyl]nona-3,5-dien-1-amine |
| SMILES | C=NCN1CCC(CCC(/C=C\CC2=CCC(C(C)NCC/C=C\C=C/C(C)CC)CC2)=C/C)CC1 |
| InChI | InChI=1S/C33H55N3/c1-6-28(3)13-10-8-9-11-24-35-29(4)33-20-18-31(19-21-33)15-12-14-30(7-2)16-17-32-22-25-36(26-23-32)27-34-5/h7-10,12-14,18,28-29,32-33,35H,5-6,11,15-17,19-27H2,1-4H3/b9-8-,13-10-,14-12-,30-7+ |
| InChIKey | NIGDKZSEOWNZDS-QWOXTQDGSA-N |
| XLogP | 8.28 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.82 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|