C24H18BrFN2O6S — CID 126662462
2-[[6-bromo-4-(3-fluoro-4-methoxyphenyl)sulfonyl-2,3-dihydro-1,4-benzoxazin-2-yl]methyl]isoindole-1,3-dione (PubChem CID 126662462) has the molecular formula C24H18BrFN2O6S and a molecular weight of 561.39 g/mol. Its IUPAC name is 2-[[6-bromo-4-(3-fluoro-4-methoxyphenyl)sulfonyl-2,3-dihydro-1,4-benzoxazin-2-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[6-bromo-4-(3-fluoro-4-methoxyphenyl)sulfonyl-2,3-dihydro-1,4-benzoxazin-2-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 126662462 |
| Molecular Formula | C24H18BrFN2O6S |
| Molecular Weight | 561.39 g/mol |
| Exact Mass | 560.01 |
| IUPAC Name | 2-[[6-bromo-4-(3-fluoro-4-methoxyphenyl)sulfonyl-2,3-dihydro-1,4-benzoxazin-2-yl]methyl]isoindole-1,3-dione |
| SMILES | COc1ccc(S(=O)(=O)N2CC(CN3C(=O)c4ccccc4C3=O)Oc3ccc(Br)cc32)cc1F |
| InChI | InChI=1S/C24H18BrFN2O6S/c1-33-21-9-7-16(11-19(21)26)35(31,32)28-13-15(34-22-8-6-14(25)10-20(22)28)12-27-23(29)17-4-2-3-5-18(17)24(27)30/h2-11,15H,12-13H2,1H3 |
| InChIKey | CKUACHNLKPURIM-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.39 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|