About 4-methyl-1-(3,3,3-trifluoroprop-1-en-2-yl)piperidine
4-methyl-1-(3,3,3-trifluoroprop-1-en-2-yl)piperidine (PubChem CID 126663367) has the molecular formula C9H14F3N
and a molecular weight of 193.21 g/mol. Its IUPAC name is 4-methyl-1-(3,3,3-trifluoroprop-1-en-2-yl)piperidine.
Analyze 4-methyl-1-(3,3,3-trifluoroprop-1-en-2-yl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1-(3,3,3-trifluoroprop-1-en-2-yl)piperidine?
The IUPAC name of 4-methyl-1-(3,3,3-trifluoroprop-1-en-2-yl)piperidine (CID 126663367) is 4-methyl-1-(3,3,3-trifluoroprop-1-en-2-yl)piperidine.
What is the SMILES notation for 4-methyl-1-(3,3,3-trifluoroprop-1-en-2-yl)piperidine?
The canonical SMILES for 4-methyl-1-(3,3,3-trifluoroprop-1-en-2-yl)piperidine is C=C(N1CCC(C)CC1)C(F)(F)F.
What is the InChIKey of 4-methyl-1-(3,3,3-trifluoroprop-1-en-2-yl)piperidine?
The InChIKey is KLASKMZUKMDJTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14F3N/c1-7-3-5-13(6-4-7)8(2)9(10,11)12/h7H,2-6H2,1H3.
What are the key properties of 4-methyl-1-(3,3,3-trifluoroprop-1-en-2-yl)piperidine?
4-methyl-1-(3,3,3-trifluoroprop-1-en-2-yl)piperidine has a molecular weight of 193.21 g/mol, XLogP of 2.79, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1-(3,3,3-trifluoroprop-1-en-2-yl)piperidine is sourced from PubChem (CID 126663367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).