About 1-[(Z)-1,3,3,3-tetrafluoroprop-1-en-2-yl]piperidine
1-[(Z)-1,3,3,3-tetrafluoroprop-1-en-2-yl]piperidine (PubChem CID 130418350) has the molecular formula C8H11F4N
and a molecular weight of 197.17 g/mol. Its IUPAC name is 1-[(Z)-1,3,3,3-tetrafluoroprop-1-en-2-yl]piperidine.
Analyze 1-[(Z)-1,3,3,3-tetrafluoroprop-1-en-2-yl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(Z)-1,3,3,3-tetrafluoroprop-1-en-2-yl]piperidine?
The IUPAC name of 1-[(Z)-1,3,3,3-tetrafluoroprop-1-en-2-yl]piperidine (CID 130418350) is 1-[(Z)-1,3,3,3-tetrafluoroprop-1-en-2-yl]piperidine.
What is the SMILES notation for 1-[(Z)-1,3,3,3-tetrafluoroprop-1-en-2-yl]piperidine?
The canonical SMILES for 1-[(Z)-1,3,3,3-tetrafluoroprop-1-en-2-yl]piperidine is F/C=C(\N1CCCCC1)C(F)(F)F.
What is the InChIKey of 1-[(Z)-1,3,3,3-tetrafluoroprop-1-en-2-yl]piperidine?
The InChIKey is WPJRFDMCLXPOLN-SREVYHEPSA-N. The full InChI is InChI=1S/C8H11F4N/c9-6-7(8(10,11)12)13-4-2-1-3-5-13/h6H,1-5H2/b7-6-.
What are the key properties of 1-[(Z)-1,3,3,3-tetrafluoroprop-1-en-2-yl]piperidine?
1-[(Z)-1,3,3,3-tetrafluoroprop-1-en-2-yl]piperidine has a molecular weight of 197.17 g/mol, XLogP of 2.85, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(Z)-1,3,3,3-tetrafluoroprop-1-en-2-yl]piperidine is sourced from PubChem (CID 130418350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).