C8H8F7N — CID 130208623
3,5-difluoro-1-[(E)-1,2,3,3,3-pentafluoroprop-1-enyl]piperidine (PubChem CID 130208623) has the molecular formula C8H8F7N and a molecular weight of 251.14 g/mol. Its IUPAC name is 3,5-difluoro-1-[(E)-1,2,3,3,3-pentafluoroprop-1-enyl]piperidine.
| Compound Name | 3,5-difluoro-1-[(E)-1,2,3,3,3-pentafluoroprop-1-enyl]piperidine |
|---|---|
| PubChem CID | 130208623 |
| Molecular Formula | C8H8F7N |
| Molecular Weight | 251.14 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | 3,5-difluoro-1-[(E)-1,2,3,3,3-pentafluoroprop-1-enyl]piperidine |
| SMILES | F/C(=C(/F)C(F)(F)F)N1CC(F)CC(F)C1 |
| InChI | InChI=1S/C8H8F7N/c9-4-1-5(10)3-16(2-4)7(12)6(11)8(13,14)15/h4-5H,1-3H2/b7-6- |
| InChIKey | VTNDOSFABFNNKE-SREVYHEPSA-N |
| XLogP | 3.04 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.14 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|