C20H20N4O3 — CID 126666042
tert-butyl N-[[3-[3-cyano-5-(furan-2-yl)pyrazol-1-yl]phenyl]methyl]carbamate (PubChem CID 126666042) has the molecular formula C20H20N4O3 and a molecular weight of 364.41 g/mol. Its IUPAC name is tert-butyl N-[[3-[3-cyano-5-(furan-2-yl)pyrazol-1-yl]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[3-[3-cyano-5-(furan-2-yl)pyrazol-1-yl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 126666042 |
| Molecular Formula | C20H20N4O3 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | tert-butyl N-[[3-[3-cyano-5-(furan-2-yl)pyrazol-1-yl]phenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cccc(-n2nc(C#N)cc2-c2ccco2)c1 |
| InChI | InChI=1S/C20H20N4O3/c1-20(2,3)27-19(25)22-13-14-6-4-7-16(10-14)24-17(11-15(12-21)23-24)18-8-5-9-26-18/h4-11H,13H2,1-3H3,(H,22,25) |
| InChIKey | ONPYEUHQNKCLLS-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 93.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |