C19H18ClN3O4 — CID 32614568
methyl 4-[[1-(3-chlorophenyl)-5-(furan-2-yl)pyrazole-3-carbonyl]amino]butanoate (PubChem CID 32614568) has the molecular formula C19H18ClN3O4 and a molecular weight of 387.82 g/mol. Its IUPAC name is methyl 4-[[1-(3-chlorophenyl)-5-(furan-2-yl)pyrazole-3-carbonyl]amino]butanoate.
| Compound Name | methyl 4-[[1-(3-chlorophenyl)-5-(furan-2-yl)pyrazole-3-carbonyl]amino]butanoate |
|---|---|
| PubChem CID | 32614568 |
| Molecular Formula | C19H18ClN3O4 |
| Molecular Weight | 387.82 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | methyl 4-[[1-(3-chlorophenyl)-5-(furan-2-yl)pyrazole-3-carbonyl]amino]butanoate |
| SMILES | COC(=O)CCCNC(=O)c1cc(-c2ccco2)n(-c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C19H18ClN3O4/c1-26-18(24)8-3-9-21-19(25)15-12-16(17-7-4-10-27-17)23(22-15)14-6-2-5-13(20)11-14/h2,4-7,10-12H,3,8-9H2,1H3,(H,21,25) |
| InChIKey | VXYQVAAFOAMCND-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.82 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|