C21H17ClN4O4 — CID 32617649
1-(3-chlorophenyl)-N'-(2,5-dimethylfuran-3-carbonyl)-5-(furan-2-yl)pyrazole-3-carbohydrazide (PubChem CID 32617649) has the molecular formula C21H17ClN4O4 and a molecular weight of 424.84 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N'-(2,5-dimethylfuran-3-carbonyl)-5-(furan-2-yl)pyrazole-3-carbohydrazide.
| Compound Name | 1-(3-chlorophenyl)-N'-(2,5-dimethylfuran-3-carbonyl)-5-(furan-2-yl)pyrazole-3-carbohydrazide |
|---|---|
| PubChem CID | 32617649 |
| Molecular Formula | C21H17ClN4O4 |
| Molecular Weight | 424.84 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | 1-(3-chlorophenyl)-N'-(2,5-dimethylfuran-3-carbonyl)-5-(furan-2-yl)pyrazole-3-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNC(=O)c2cc(-c3ccco3)n(-c3cccc(Cl)c3)n2)c(C)o1 |
| InChI | InChI=1S/C21H17ClN4O4/c1-12-9-16(13(2)30-12)20(27)23-24-21(28)17-11-18(19-7-4-8-29-19)26(25-17)15-6-3-5-14(22)10-15/h3-11H,1-2H3,(H,23,27)(H,24,28) |
| InChIKey | HWTSLYFVQVXERF-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 102.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.84 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|