C19H15ClN4O3 — CID 49395004
1-(3-chlorophenyl)-5-(furan-2-yl)-N-[2-oxo-2-(prop-2-ynylamino)ethyl]pyrazole-3-carboxamide (PubChem CID 49395004) has the molecular formula C19H15ClN4O3 and a molecular weight of 382.81 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-5-(furan-2-yl)-N-[2-oxo-2-(prop-2-ynylamino)ethyl]pyrazole-3-carboxamide.
| Compound Name | 1-(3-chlorophenyl)-5-(furan-2-yl)-N-[2-oxo-2-(prop-2-ynylamino)ethyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 49395004 |
| Molecular Formula | C19H15ClN4O3 |
| Molecular Weight | 382.81 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 1-(3-chlorophenyl)-5-(furan-2-yl)-N-[2-oxo-2-(prop-2-ynylamino)ethyl]pyrazole-3-carboxamide |
| SMILES | C#CCNC(=O)CNC(=O)c1cc(-c2ccco2)n(-c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C19H15ClN4O3/c1-2-8-21-18(25)12-22-19(26)15-11-16(17-7-4-9-27-17)24(23-15)14-6-3-5-13(20)10-14/h1,3-7,9-11H,8,12H2,(H,21,25)(H,22,26) |
| InChIKey | JFRUXZFNEATSHZ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 89.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.81 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|