C25H26F3N3O4S — CID 126668974
(4R)-4-[2-(4-methoxybutyl)-4-(trifluoromethyl)phenyl]-N-pyrimidin-4-yl-3,4-dihydro-2H-chromene-7-sulfonamide (PubChem CID 126668974) has the molecular formula C25H26F3N3O4S and a molecular weight of 521.56 g/mol. Its IUPAC name is (4R)-4-[2-(4-methoxybutyl)-4-(trifluoromethyl)phenyl]-N-pyrimidin-4-yl-3,4-dihydro-2H-chromene-7-sulfonamide.
| Compound Name | (4R)-4-[2-(4-methoxybutyl)-4-(trifluoromethyl)phenyl]-N-pyrimidin-4-yl-3,4-dihydro-2H-chromene-7-sulfonamide |
|---|---|
| PubChem CID | 126668974 |
| Molecular Formula | C25H26F3N3O4S |
| Molecular Weight | 521.56 g/mol |
| Exact Mass | 521.16 |
| IUPAC Name | (4R)-4-[2-(4-methoxybutyl)-4-(trifluoromethyl)phenyl]-N-pyrimidin-4-yl-3,4-dihydro-2H-chromene-7-sulfonamide |
| SMILES | COCCCCc1cc(C(F)(F)F)ccc1[C@H]1CCOc2cc(S(=O)(=O)Nc3ccncn3)ccc21 |
| InChI | InChI=1S/C25H26F3N3O4S/c1-34-12-3-2-4-17-14-18(25(26,27)28)5-7-20(17)21-10-13-35-23-15-19(6-8-22(21)23)36(32,33)31-24-9-11-29-16-30-24/h5-9,11,14-16,21H,2-4,10,12-13H2,1H3,(H,29,30,31)/t21-/m1/s1 |
| InChIKey | JTWZWBOVYRJYKS-OAQYLSRUSA-N |
| XLogP | 5.18 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.56 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|