C26H26F4N2O4S — CID 126650573
(4S)-N-(6-fluoro-2-pyridinyl)-4-[2-(4-methoxybutyl)-4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-chromene-7-sulfonamide (PubChem CID 126650573) has the molecular formula C26H26F4N2O4S and a molecular weight of 538.56 g/mol. Its IUPAC name is (4S)-N-(6-fluoro-2-pyridinyl)-4-[2-(4-methoxybutyl)-4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-chromene-7-sulfonamide.
| Compound Name | (4S)-N-(6-fluoro-2-pyridinyl)-4-[2-(4-methoxybutyl)-4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-chromene-7-sulfonamide |
|---|---|
| PubChem CID | 126650573 |
| Molecular Formula | C26H26F4N2O4S |
| Molecular Weight | 538.56 g/mol |
| Exact Mass | 538.15 |
| IUPAC Name | (4S)-N-(6-fluoro-2-pyridinyl)-4-[2-(4-methoxybutyl)-4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-chromene-7-sulfonamide |
| SMILES | COCCCCc1cc(C(F)(F)F)ccc1[C@@H]1CCOc2cc(S(=O)(=O)Nc3cccc(F)n3)ccc21 |
| InChI | InChI=1S/C26H26F4N2O4S/c1-35-13-3-2-5-17-15-18(26(28,29)30)8-10-20(17)21-12-14-36-23-16-19(9-11-22(21)23)37(33,34)32-25-7-4-6-24(27)31-25/h4,6-11,15-16,21H,2-3,5,12-14H2,1H3,(H,31,32)/t21-/m0/s1 |
| InChIKey | BQFTZRJBEUUTLJ-NRFANRHFSA-N |
| XLogP | 5.92 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.56 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|