C22H18F4N2O2S — CID 126668531
6-fluoro-N-[[4-[2-methoxy-4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-chromen-7-yl]sulfanyl]pyridin-2-amine (PubChem CID 126668531) has the molecular formula C22H18F4N2O2S and a molecular weight of 450.46 g/mol. Its IUPAC name is 6-fluoro-N-[[4-[2-methoxy-4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-chromen-7-yl]sulfanyl]pyridin-2-amine.
| Compound Name | 6-fluoro-N-[[4-[2-methoxy-4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-chromen-7-yl]sulfanyl]pyridin-2-amine |
|---|---|
| PubChem CID | 126668531 |
| Molecular Formula | C22H18F4N2O2S |
| Molecular Weight | 450.46 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | 6-fluoro-N-[[4-[2-methoxy-4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-chromen-7-yl]sulfanyl]pyridin-2-amine |
| SMILES | COc1cc(C(F)(F)F)ccc1C1CCOc2cc(SNc3cccc(F)n3)ccc21 |
| InChI | InChI=1S/C22H18F4N2O2S/c1-29-18-11-13(22(24,25)26)5-7-16(18)15-9-10-30-19-12-14(6-8-17(15)19)31-28-21-4-2-3-20(23)27-21/h2-8,11-12,15H,9-10H2,1H3,(H,27,28) |
| InChIKey | AOZHPCMBJRPIET-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.46 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|