C27H27FN4O2S — CID 145268047
6-fluoro-N-[[4-[2-(2-methylpyrazol-3-yl)-4-propan-2-yloxyphenyl]-3,4-dihydro-2H-chromen-7-yl]sulfanyl]pyridin-2-amine (PubChem CID 145268047) has the molecular formula C27H27FN4O2S and a molecular weight of 490.60 g/mol. Its IUPAC name is 6-fluoro-N-[[4-[2-(2-methylpyrazol-3-yl)-4-propan-2-yloxyphenyl]-3,4-dihydro-2H-chromen-7-yl]sulfanyl]pyridin-2-amine.
| Compound Name | 6-fluoro-N-[[4-[2-(2-methylpyrazol-3-yl)-4-propan-2-yloxyphenyl]-3,4-dihydro-2H-chromen-7-yl]sulfanyl]pyridin-2-amine |
|---|---|
| PubChem CID | 145268047 |
| Molecular Formula | C27H27FN4O2S |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | 6-fluoro-N-[[4-[2-(2-methylpyrazol-3-yl)-4-propan-2-yloxyphenyl]-3,4-dihydro-2H-chromen-7-yl]sulfanyl]pyridin-2-amine |
| SMILES | CC(C)Oc1ccc(C2CCOc3cc(SNc4cccc(F)n4)ccc32)c(-c2ccnn2C)c1 |
| InChI | InChI=1S/C27H27FN4O2S/c1-17(2)34-18-7-9-20(23(15-18)24-11-13-29-32(24)3)21-12-14-33-25-16-19(8-10-22(21)25)35-31-27-6-4-5-26(28)30-27/h4-11,13,15-17,21H,12,14H2,1-3H3,(H,30,31) |
| InChIKey | ZMERDGBRKYKYLG-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 61.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|