C27H19F4N3O3S — CID 145268058
4-[2-[(4R)-7-[(5-fluoropyrimidin-2-yl)amino]sulfanyl-3,4-dihydro-2H-chromen-4-yl]-5-(trifluoromethyl)phenyl]benzoic acid (PubChem CID 145268058) has the molecular formula C27H19F4N3O3S and a molecular weight of 541.53 g/mol. Its IUPAC name is 4-[2-[(4R)-7-[(5-fluoropyrimidin-2-yl)amino]sulfanyl-3,4-dihydro-2H-chromen-4-yl]-5-(trifluoromethyl)phenyl]benzoic acid.
| Compound Name | 4-[2-[(4R)-7-[(5-fluoropyrimidin-2-yl)amino]sulfanyl-3,4-dihydro-2H-chromen-4-yl]-5-(trifluoromethyl)phenyl]benzoic acid |
|---|---|
| PubChem CID | 145268058 |
| Molecular Formula | C27H19F4N3O3S |
| Molecular Weight | 541.53 g/mol |
| Exact Mass | 541.11 |
| IUPAC Name | 4-[2-[(4R)-7-[(5-fluoropyrimidin-2-yl)amino]sulfanyl-3,4-dihydro-2H-chromen-4-yl]-5-(trifluoromethyl)phenyl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2cc(C(F)(F)F)ccc2[C@H]2CCOc3cc(SNc4ncc(F)cn4)ccc32)cc1 |
| InChI | InChI=1S/C27H19F4N3O3S/c28-18-13-32-26(33-14-18)34-38-19-6-8-22-21(9-10-37-24(22)12-19)20-7-5-17(27(29,30)31)11-23(20)15-1-3-16(4-2-15)25(35)36/h1-8,11-14,21H,9-10H2,(H,35,36)(H,32,33,34)/t21-/m1/s1 |
| InChIKey | BKOJWOMODFAELP-OAQYLSRUSA-N |
| XLogP | 7.03 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.53 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|