C22H20F5N3OS — CID 145268137
N-(3,4-dihydro-2H-chromen-7-ylsulfanyl)-5-fluoropyrimidin-2-amine;1-(2-fluoroethyl)-3-(trifluoromethyl)benzene (PubChem CID 145268137) has the molecular formula C22H20F5N3OS and a molecular weight of 469.48 g/mol. Its IUPAC name is N-(3,4-dihydro-2H-chromen-7-ylsulfanyl)-5-fluoropyrimidin-2-amine;1-(2-fluoroethyl)-3-(trifluoromethyl)benzene.
| Compound Name | N-(3,4-dihydro-2H-chromen-7-ylsulfanyl)-5-fluoropyrimidin-2-amine;1-(2-fluoroethyl)-3-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 145268137 |
| Molecular Formula | C22H20F5N3OS |
| Molecular Weight | 469.48 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | N-(3,4-dihydro-2H-chromen-7-ylsulfanyl)-5-fluoropyrimidin-2-amine;1-(2-fluoroethyl)-3-(trifluoromethyl)benzene |
| SMILES | FCCc1cccc(C(F)(F)F)c1.Fc1cnc(NSc2ccc3c(c2)OCCC3)nc1 |
| InChI | InChI=1S/C13H12FN3OS.C9H8F4/c14-10-7-15-13(16-8-10)17-19-11-4-3-9-2-1-5-18-12(9)6-11;10-5-4-7-2-1-3-8(6-7)9(11,12)13/h3-4,6-8H,1-2,5H2,(H,15,16,17);1-3,6H,4-5H2 |
| InChIKey | RMBCDNCSLLCFRK-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.48 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|