C22H21F4N3OS — CID 145268053
N-(3,4-dihydro-2H-chromen-7-ylsulfanyl)pyrimidin-4-amine;1-(2-fluoroethyl)-3-(trifluoromethyl)benzene (PubChem CID 145268053) has the molecular formula C22H21F4N3OS and a molecular weight of 451.49 g/mol. Its IUPAC name is N-(3,4-dihydro-2H-chromen-7-ylsulfanyl)pyrimidin-4-amine;1-(2-fluoroethyl)-3-(trifluoromethyl)benzene.
| Compound Name | N-(3,4-dihydro-2H-chromen-7-ylsulfanyl)pyrimidin-4-amine;1-(2-fluoroethyl)-3-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 145268053 |
| Molecular Formula | C22H21F4N3OS |
| Molecular Weight | 451.49 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | N-(3,4-dihydro-2H-chromen-7-ylsulfanyl)pyrimidin-4-amine;1-(2-fluoroethyl)-3-(trifluoromethyl)benzene |
| SMILES | FCCc1cccc(C(F)(F)F)c1.c1cc(NSc2ccc3c(c2)OCCC3)ncn1 |
| InChI | InChI=1S/C13H13N3OS.C9H8F4/c1-2-10-3-4-11(8-12(10)17-7-1)18-16-13-5-6-14-9-15-13;10-5-4-7-2-1-3-8(6-7)9(11,12)13/h3-6,8-9H,1-2,7H2,(H,14,15,16);1-3,6H,4-5H2 |
| InChIKey | OTVMJRIVADHWEH-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.49 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|