C24H19F4N3OS2 — CID 145268025
N-(3,4-dihydro-2H-chromen-7-ylsulfanyl)-6-fluoropyridin-2-amine;2-[3-(trifluoromethyl)phenyl]-1,3-thiazole (PubChem CID 145268025) has the molecular formula C24H19F4N3OS2 and a molecular weight of 505.56 g/mol. Its IUPAC name is N-(3,4-dihydro-2H-chromen-7-ylsulfanyl)-6-fluoropyridin-2-amine;2-[3-(trifluoromethyl)phenyl]-1,3-thiazole.
| Compound Name | N-(3,4-dihydro-2H-chromen-7-ylsulfanyl)-6-fluoropyridin-2-amine;2-[3-(trifluoromethyl)phenyl]-1,3-thiazole |
|---|---|
| PubChem CID | 145268025 |
| Molecular Formula | C24H19F4N3OS2 |
| Molecular Weight | 505.56 g/mol |
| Exact Mass | 505.09 |
| IUPAC Name | N-(3,4-dihydro-2H-chromen-7-ylsulfanyl)-6-fluoropyridin-2-amine;2-[3-(trifluoromethyl)phenyl]-1,3-thiazole |
| SMILES | FC(F)(F)c1cccc(-c2nccs2)c1.Fc1cccc(NSc2ccc3c(c2)OCCC3)n1 |
| InChI | InChI=1S/C14H13FN2OS.C10H6F3NS/c15-13-4-1-5-14(16-13)17-19-11-7-6-10-3-2-8-18-12(10)9-11;11-10(12,13)8-3-1-2-7(6-8)9-14-4-5-15-9/h1,4-7,9H,2-3,8H2,(H,16,17);1-6H |
| InChIKey | GGPLPYYBRLLPNQ-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.56 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|