C26H20F8O3S — CID 145268077
4-[2-(3-methoxypropyl)-4-(trifluoromethyl)phenyl]-7-(2,3,4,5,6-pentafluorophenoxy)sulfanyl-3,4-dihydro-2H-chromene (PubChem CID 145268077) has the molecular formula C26H20F8O3S and a molecular weight of 564.49 g/mol. Its IUPAC name is 4-[2-(3-methoxypropyl)-4-(trifluoromethyl)phenyl]-7-(2,3,4,5,6-pentafluorophenoxy)sulfanyl-3,4-dihydro-2H-chromene.
| Compound Name | 4-[2-(3-methoxypropyl)-4-(trifluoromethyl)phenyl]-7-(2,3,4,5,6-pentafluorophenoxy)sulfanyl-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 145268077 |
| Molecular Formula | C26H20F8O3S |
| Molecular Weight | 564.49 g/mol |
| Exact Mass | 564.10 |
| IUPAC Name | 4-[2-(3-methoxypropyl)-4-(trifluoromethyl)phenyl]-7-(2,3,4,5,6-pentafluorophenoxy)sulfanyl-3,4-dihydro-2H-chromene |
| SMILES | COCCCc1cc(C(F)(F)F)ccc1C1CCOc2cc(SOc3c(F)c(F)c(F)c(F)c3F)ccc21 |
| InChI | InChI=1S/C26H20F8O3S/c1-35-9-2-3-13-11-14(26(32,33)34)4-6-16(13)17-8-10-36-19-12-15(5-7-18(17)19)38-37-25-23(30)21(28)20(27)22(29)24(25)31/h4-7,11-12,17H,2-3,8-10H2,1H3 |
| InChIKey | PGHJPLACRBTZES-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.49 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|