C25H16F10O3S — CID 126668791
(2,3,4,5,6-pentafluorophenyl) 4-[2-(3,3-difluoropropyl)-4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-chromene-7-sulfinate (PubChem CID 126668791) has the molecular formula C25H16F10O3S and a molecular weight of 586.45 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 4-[2-(3,3-difluoropropyl)-4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-chromene-7-sulfinate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 4-[2-(3,3-difluoropropyl)-4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-chromene-7-sulfinate |
|---|---|
| PubChem CID | 126668791 |
| Molecular Formula | C25H16F10O3S |
| Molecular Weight | 586.45 g/mol |
| Exact Mass | 586.07 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 4-[2-(3,3-difluoropropyl)-4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-chromene-7-sulfinate |
| SMILES | O=S(Oc1c(F)c(F)c(F)c(F)c1F)c1ccc2c(c1)OCCC2c1ccc(C(F)(F)F)cc1CCC(F)F |
| InChI | InChI=1S/C25H16F10O3S/c26-18(27)6-1-11-9-12(25(33,34)35)2-4-14(11)15-7-8-37-17-10-13(3-5-16(15)17)39(36)38-24-22(31)20(29)19(28)21(30)23(24)32/h2-5,9-10,15,18H,1,6-8H2 |
| InChIKey | ZMXHLEGBALSOGM-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.45 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|