C19H16F3O6S- — CID 154520378
4-[2-(oxetan-3-yloxy)-4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-chromene-7-sulfonate (PubChem CID 154520378) has the molecular formula C19H16F3O6S- and a molecular weight of 429.39 g/mol. Its IUPAC name is 4-[2-(oxetan-3-yloxy)-4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-chromene-7-sulfonate.
| Compound Name | 4-[2-(oxetan-3-yloxy)-4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-chromene-7-sulfonate |
|---|---|
| PubChem CID | 154520378 |
| Molecular Formula | C19H16F3O6S- |
| Molecular Weight | 429.39 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | 4-[2-(oxetan-3-yloxy)-4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-chromene-7-sulfonate |
| SMILES | O=S(=O)([O-])c1ccc2c(c1)OCCC2c1ccc(C(F)(F)F)cc1OC1COC1 |
| InChI | InChI=1S/C19H17F3O6S/c20-19(21,22)11-1-3-16(18(7-11)28-12-9-26-10-12)14-5-6-27-17-8-13(29(23,24)25)2-4-15(14)17/h1-4,7-8,12,14H,5-6,9-10H2,(H,23,24,25)/p-1 |
| InChIKey | ACRZXSWIERSWLL-UHFFFAOYSA-M |
| XLogP | 3.30 |
| TPSA | 84.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.39 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|