C26H24F4N2O4S — CID 126668983
N-(6-fluoro-2-pyridinyl)-4-[2-(oxan-4-yloxy)-4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-chromene-7-sulfinamide (PubChem CID 126668983) has the molecular formula C26H24F4N2O4S and a molecular weight of 536.55 g/mol. Its IUPAC name is N-(6-fluoro-2-pyridinyl)-4-[2-(oxan-4-yloxy)-4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-chromene-7-sulfinamide.
| Compound Name | N-(6-fluoro-2-pyridinyl)-4-[2-(oxan-4-yloxy)-4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-chromene-7-sulfinamide |
|---|---|
| PubChem CID | 126668983 |
| Molecular Formula | C26H24F4N2O4S |
| Molecular Weight | 536.55 g/mol |
| Exact Mass | 536.14 |
| IUPAC Name | N-(6-fluoro-2-pyridinyl)-4-[2-(oxan-4-yloxy)-4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-chromene-7-sulfinamide |
| SMILES | O=S(Nc1cccc(F)n1)c1ccc2c(c1)OCCC2c1ccc(C(F)(F)F)cc1OC1CCOCC1 |
| InChI | InChI=1S/C26H24F4N2O4S/c27-24-2-1-3-25(31-24)32-37(33)18-5-7-20-19(10-13-35-22(20)15-18)21-6-4-16(26(28,29)30)14-23(21)36-17-8-11-34-12-9-17/h1-7,14-15,17,19H,8-13H2,(H,31,32) |
| InChIKey | SXEAKLNTPYPLKR-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.55 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|