C24H23F3IN3O3S — CID 126668633
(4R)-4-[2-(4-iodobutyl)-4-(trifluoromethyl)phenyl]-N-pyrimidin-2-yl-3,4-dihydro-2H-chromene-7-sulfonamide (PubChem CID 126668633) has the molecular formula C24H23F3IN3O3S and a molecular weight of 617.43 g/mol. Its IUPAC name is (4R)-4-[2-(4-iodobutyl)-4-(trifluoromethyl)phenyl]-N-pyrimidin-2-yl-3,4-dihydro-2H-chromene-7-sulfonamide.
| Compound Name | (4R)-4-[2-(4-iodobutyl)-4-(trifluoromethyl)phenyl]-N-pyrimidin-2-yl-3,4-dihydro-2H-chromene-7-sulfonamide |
|---|---|
| PubChem CID | 126668633 |
| Molecular Formula | C24H23F3IN3O3S |
| Molecular Weight | 617.43 g/mol |
| Exact Mass | 617.05 |
| IUPAC Name | (4R)-4-[2-(4-iodobutyl)-4-(trifluoromethyl)phenyl]-N-pyrimidin-2-yl-3,4-dihydro-2H-chromene-7-sulfonamide |
| SMILES | O=S(=O)(Nc1ncccn1)c1ccc2c(c1)OCC[C@@H]2c1ccc(C(F)(F)F)cc1CCCCI |
| InChI | InChI=1S/C24H23F3IN3O3S/c25-24(26,27)17-5-7-19(16(14-17)4-1-2-10-28)20-9-13-34-22-15-18(6-8-21(20)22)35(32,33)31-23-29-11-3-12-30-23/h3,5-8,11-12,14-15,20H,1-2,4,9-10,13H2,(H,29,30,31)/t20-/m1/s1 |
| InChIKey | IIYIYBZZKNWNBB-HXUWFJFHSA-N |
| XLogP | 5.97 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.43 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|