C25H25F3IN3O3S — CID 126668634
(4S)-4-[2-(4-iodobutyl)-4-(trifluoromethyl)phenyl]-4-methyl-N-pyrimidin-2-yl-2,3-dihydrochromene-7-sulfonamide (PubChem CID 126668634) has the molecular formula C25H25F3IN3O3S and a molecular weight of 631.46 g/mol. Its IUPAC name is (4S)-4-[2-(4-iodobutyl)-4-(trifluoromethyl)phenyl]-4-methyl-N-pyrimidin-2-yl-2,3-dihydrochromene-7-sulfonamide.
| Compound Name | (4S)-4-[2-(4-iodobutyl)-4-(trifluoromethyl)phenyl]-4-methyl-N-pyrimidin-2-yl-2,3-dihydrochromene-7-sulfonamide |
|---|---|
| PubChem CID | 126668634 |
| Molecular Formula | C25H25F3IN3O3S |
| Molecular Weight | 631.46 g/mol |
| Exact Mass | 631.06 |
| IUPAC Name | (4S)-4-[2-(4-iodobutyl)-4-(trifluoromethyl)phenyl]-4-methyl-N-pyrimidin-2-yl-2,3-dihydrochromene-7-sulfonamide |
| SMILES | C[C@@]1(c2ccc(C(F)(F)F)cc2CCCCI)CCOc2cc(S(=O)(=O)Nc3ncccn3)ccc21 |
| InChI | InChI=1S/C25H25F3IN3O3S/c1-24(20-8-6-18(25(26,27)28)15-17(20)5-2-3-11-29)10-14-35-22-16-19(7-9-21(22)24)36(33,34)32-23-30-12-4-13-31-23/h4,6-9,12-13,15-16H,2-3,5,10-11,14H2,1H3,(H,30,31,32)/t24-/m0/s1 |
| InChIKey | KUNJJLWQEVUCQN-DEOSSOPVSA-N |
| XLogP | 6.14 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.46 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|