About 3-(2-fluorophenyl)-N,5-dimethylaniline
3-(2-fluorophenyl)-N,5-dimethylaniline (PubChem CID 126670489) has the molecular formula C14H14FN
and a molecular weight of 215.27 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-N,5-dimethylaniline.
Molecular Properties
| Compound Name | 3-(2-fluorophenyl)-N,5-dimethylaniline |
| PubChem CID | 126670489 |
| Molecular Formula | C14H14FN |
| Molecular Weight | 215.27 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 3-(2-fluorophenyl)-N,5-dimethylaniline |
| SMILES | CNc1cc(C)cc(-c2ccccc2F)c1 |
| InChI | InChI=1S/C14H14FN/c1-10-7-11(9-12(8-10)16-2)13-5-3-4-6-14(13)15/h3-9,16H,1-2H3 |
| InChIKey | BFQRNHBZOMGVTM-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.27 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(2-fluorophenyl)-N,5-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-fluorophenyl)-N,5-dimethylaniline?
The IUPAC name of 3-(2-fluorophenyl)-N,5-dimethylaniline (CID 126670489) is 3-(2-fluorophenyl)-N,5-dimethylaniline.
What is the SMILES notation for 3-(2-fluorophenyl)-N,5-dimethylaniline?
The canonical SMILES for 3-(2-fluorophenyl)-N,5-dimethylaniline is CNc1cc(C)cc(-c2ccccc2F)c1.
What is the InChIKey of 3-(2-fluorophenyl)-N,5-dimethylaniline?
The InChIKey is BFQRNHBZOMGVTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14FN/c1-10-7-11(9-12(8-10)16-2)13-5-3-4-6-14(13)15/h3-9,16H,1-2H3.
What are the key properties of 3-(2-fluorophenyl)-N,5-dimethylaniline?
3-(2-fluorophenyl)-N,5-dimethylaniline has a molecular weight of 215.27 g/mol, XLogP of 3.84, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-fluorophenyl)-N,5-dimethylaniline is sourced from PubChem (CID 126670489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).