C13H12F3N3O2 — CID 126670826
(1R,3S,5S)-N-[6-(trifluoromethoxy)-2-pyridinyl]-2-azabicyclo[3.2.0]hept-6-ene-3-carboxamide (PubChem CID 126670826) has the molecular formula C13H12F3N3O2 and a molecular weight of 299.25 g/mol. Its IUPAC name is (1R,3S,5S)-N-[6-(trifluoromethoxy)-2-pyridinyl]-2-azabicyclo[3.2.0]hept-6-ene-3-carboxamide.
| Compound Name | (1R,3S,5S)-N-[6-(trifluoromethoxy)-2-pyridinyl]-2-azabicyclo[3.2.0]hept-6-ene-3-carboxamide |
|---|---|
| PubChem CID | 126670826 |
| Molecular Formula | C13H12F3N3O2 |
| Molecular Weight | 299.25 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | (1R,3S,5S)-N-[6-(trifluoromethoxy)-2-pyridinyl]-2-azabicyclo[3.2.0]hept-6-ene-3-carboxamide |
| SMILES | O=C(Nc1cccc(OC(F)(F)F)n1)[C@@H]1C[C@H]2C=C[C@H]2N1 |
| InChI | InChI=1S/C13H12F3N3O2/c14-13(15,16)21-11-3-1-2-10(18-11)19-12(20)9-6-7-4-5-8(7)17-9/h1-5,7-9,17H,6H2,(H,18,19,20)/t7-,8-,9+/m1/s1 |
| InChIKey | MLRDWFPJBONPBX-HLTSFMKQSA-N |
| XLogP | 1.84 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.25 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|