C14H25NO3S — CID 126677638
(E)-3-hydroxy-N-(4-methyl-2-oxohexan-3-yl)-7-sulfanylhept-4-enamide (PubChem CID 126677638) has the molecular formula C14H25NO3S and a molecular weight of 287.43 g/mol. Its IUPAC name is (E)-3-hydroxy-N-(4-methyl-2-oxohexan-3-yl)-7-sulfanylhept-4-enamide.
| Compound Name | (E)-3-hydroxy-N-(4-methyl-2-oxohexan-3-yl)-7-sulfanylhept-4-enamide |
|---|---|
| PubChem CID | 126677638 |
| Molecular Formula | C14H25NO3S |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | (E)-3-hydroxy-N-(4-methyl-2-oxohexan-3-yl)-7-sulfanylhept-4-enamide |
| SMILES | CCC(C)C(NC(=O)CC(O)/C=C/CCS)C(C)=O |
| InChI | InChI=1S/C14H25NO3S/c1-4-10(2)14(11(3)16)15-13(18)9-12(17)7-5-6-8-19/h5,7,10,12,14,17,19H,4,6,8-9H2,1-3H3,(H,15,18)/b7-5+ |
| InChIKey | PLVUMVNFBJVJGM-FNORWQNLSA-N |
| XLogP | 1.73 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|