C24H40N2O8S4 — CID 135321994
(2R)-2-[[(E)-7-[[(E)-7-[[(1R)-1-carboxy-3-methylsulfanylpropyl]amino]-5-hydroxy-7-oxohept-3-enyl]disulfanyl]-3-hydroxyhept-4-enoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 135321994) has the molecular formula C24H40N2O8S4 and a molecular weight of 612.86 g/mol. Its IUPAC name is (2R)-2-[[(E)-7-[[(E)-7-[[(1R)-1-carboxy-3-methylsulfanylpropyl]amino]-5-hydroxy-7-oxohept-3-enyl]disulfanyl]-3-hydroxyhept-4-enoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2R)-2-[[(E)-7-[[(E)-7-[[(1R)-1-carboxy-3-methylsulfanylpropyl]amino]-5-hydroxy-7-oxohept-3-enyl]disulfanyl]-3-hydroxyhept-4-enoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 135321994 |
| Molecular Formula | C24H40N2O8S4 |
| Molecular Weight | 612.86 g/mol |
| Exact Mass | 612.17 |
| IUPAC Name | (2R)-2-[[(E)-7-[[(E)-7-[[(1R)-1-carboxy-3-methylsulfanylpropyl]amino]-5-hydroxy-7-oxohept-3-enyl]disulfanyl]-3-hydroxyhept-4-enoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@@H](NC(=O)CC(O)/C=C/CCSSCC/C=C/C(O)CC(=O)N[C@H](CCSC)C(=O)O)C(=O)O |
| InChI | InChI=1S/C24H40N2O8S4/c1-35-13-9-19(23(31)32)25-21(29)15-17(27)7-3-5-11-37-38-12-6-4-8-18(28)16-22(30)26-20(24(33)34)10-14-36-2/h3-4,7-8,17-20,27-28H,5-6,9-16H2,1-2H3,(H,25,29)(H,26,30)(H,31,32)(H,33,34)/b7-3+,8-4+/t17?,18?,19-,20-/m1/s1 |
| InChIKey | HWVCFSFZGGJHAN-PMNFDRKVSA-N |
| XLogP | 2.41 |
| TPSA | 173.26 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.86 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|