C19H18BrN — CID 126679396
(3E,5Z)-3-bromo-2-methyl-1-phenyl-2,7-dihydro-1-benzazonine (PubChem CID 126679396) has the molecular formula C19H18BrN and a molecular weight of 340.26 g/mol. Its IUPAC name is (3E,5Z)-3-bromo-2-methyl-1-phenyl-2,7-dihydro-1-benzazonine.
| Compound Name | (3E,5Z)-3-bromo-2-methyl-1-phenyl-2,7-dihydro-1-benzazonine |
|---|---|
| PubChem CID | 126679396 |
| Molecular Formula | C19H18BrN |
| Molecular Weight | 340.26 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | (3E,5Z)-3-bromo-2-methyl-1-phenyl-2,7-dihydro-1-benzazonine |
| SMILES | CC1/C(Br)=C\C=C/Cc2ccccc2N1c1ccccc1 |
| InChI | InChI=1S/C19H18BrN/c1-15-18(20)13-7-5-9-16-10-6-8-14-19(16)21(15)17-11-3-2-4-12-17/h2-8,10-15H,9H2,1H3/b7-5-,18-13+ |
| InChIKey | KTJKWOXSVWLTLW-LSDIFGGWSA-N |
| XLogP | 5.60 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.26 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |