About (3E,5Z)-3-bromo-2-methyl-1-phenyl-2,7-dihydro-1-benzazonine
(3E,5Z)-3-bromo-2-methyl-1-phenyl-2,7-dihydro-1-benzazonine (PubChem CID 126679396) has the molecular formula C19H18BrN
and a molecular weight of 340.26 g/mol. Its IUPAC name is (3E,5Z)-3-bromo-2-methyl-1-phenyl-2,7-dihydro-1-benzazonine.
Molecular Properties
| Compound Name | (3E,5Z)-3-bromo-2-methyl-1-phenyl-2,7-dihydro-1-benzazonine |
| PubChem CID | 126679396 |
| Molecular Formula | C19H18BrN |
| Molecular Weight | 340.26 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | (3E,5Z)-3-bromo-2-methyl-1-phenyl-2,7-dihydro-1-benzazonine |
| SMILES | CC1/C(Br)=C\C=C/Cc2ccccc2N1c1ccccc1 |
| InChI | InChI=1S/C19H18BrN/c1-15-18(20)13-7-5-9-16-10-6-8-14-19(16)21(15)17-11-3-2-4-12-17/h2-8,10-15H,9H2,1H3/b7-5-,18-13+ |
| InChIKey | KTJKWOXSVWLTLW-LSDIFGGWSA-N |
| XLogP | 5.60 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.26 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3E,5Z)-3-bromo-2-methyl-1-phenyl-2,7-dihydro-1-benzazonine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E,5Z)-3-bromo-2-methyl-1-phenyl-2,7-dihydro-1-benzazonine?
The IUPAC name of (3E,5Z)-3-bromo-2-methyl-1-phenyl-2,7-dihydro-1-benzazonine (CID 126679396) is (3E,5Z)-3-bromo-2-methyl-1-phenyl-2,7-dihydro-1-benzazonine.
What is the SMILES notation for (3E,5Z)-3-bromo-2-methyl-1-phenyl-2,7-dihydro-1-benzazonine?
The canonical SMILES for (3E,5Z)-3-bromo-2-methyl-1-phenyl-2,7-dihydro-1-benzazonine is CC1/C(Br)=C\C=C/Cc2ccccc2N1c1ccccc1.
What is the InChIKey of (3E,5Z)-3-bromo-2-methyl-1-phenyl-2,7-dihydro-1-benzazonine?
The InChIKey is KTJKWOXSVWLTLW-LSDIFGGWSA-N. The full InChI is InChI=1S/C19H18BrN/c1-15-18(20)13-7-5-9-16-10-6-8-14-19(16)21(15)17-11-3-2-4-12-17/h2-8,10-15H,9H2,1H3/b7-5-,18-13+.
What are the key properties of (3E,5Z)-3-bromo-2-methyl-1-phenyl-2,7-dihydro-1-benzazonine?
(3E,5Z)-3-bromo-2-methyl-1-phenyl-2,7-dihydro-1-benzazonine has a molecular weight of 340.26 g/mol, XLogP of 5.60, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3E,5Z)-3-bromo-2-methyl-1-phenyl-2,7-dihydro-1-benzazonine is sourced from PubChem (CID 126679396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).