C15H14N2O2 — CID 99983793
(2S)-N-hydroxy-1-phenyl-2,3-dihydroindole-2-carboxamide (PubChem CID 99983793) has the molecular formula C15H14N2O2 and a molecular weight of 254.29 g/mol. Its IUPAC name is (2S)-N-hydroxy-1-phenyl-2,3-dihydroindole-2-carboxamide.
| Compound Name | (2S)-N-hydroxy-1-phenyl-2,3-dihydroindole-2-carboxamide |
|---|---|
| PubChem CID | 99983793 |
| Molecular Formula | C15H14N2O2 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | (2S)-N-hydroxy-1-phenyl-2,3-dihydroindole-2-carboxamide |
| SMILES | O=C(NO)[C@@H]1Cc2ccccc2N1c1ccccc1 |
| InChI | InChI=1S/C15H14N2O2/c18-15(16-19)14-10-11-6-4-5-9-13(11)17(14)12-7-2-1-3-8-12/h1-9,14,19H,10H2,(H,16,18)/t14-/m0/s1 |
| InChIKey | FKRVZQUZSVSWKE-AWEZNQCLSA-N |
| XLogP | 2.25 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|