C16H12ClN3S — CID 126680961
N-(4-chlorophenyl)-2-ethenylimidazo[1,2-a]pyridine-3-carbothioamide (PubChem CID 126680961) has the molecular formula C16H12ClN3S and a molecular weight of 313.81 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-ethenylimidazo[1,2-a]pyridine-3-carbothioamide.
| Compound Name | N-(4-chlorophenyl)-2-ethenylimidazo[1,2-a]pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 126680961 |
| Molecular Formula | C16H12ClN3S |
| Molecular Weight | 313.81 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | N-(4-chlorophenyl)-2-ethenylimidazo[1,2-a]pyridine-3-carbothioamide |
| SMILES | C=Cc1nc2ccccn2c1C(=S)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H12ClN3S/c1-2-13-15(20-10-4-3-5-14(20)19-13)16(21)18-12-8-6-11(17)7-9-12/h2-10H,1H2,(H,18,21) |
| InChIKey | HJBSBDZZRKMMMO-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.81 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|