C12H9ClN4 — CID 56697911
N-(4-chlorophenyl)-[1,2,4]triazolo[4,3-a]pyridin-3-amine (PubChem CID 56697911) has the molecular formula C12H9ClN4 and a molecular weight of 244.69 g/mol. Its IUPAC name is N-(4-chlorophenyl)-[1,2,4]triazolo[4,3-a]pyridin-3-amine.
| Compound Name | N-(4-chlorophenyl)-[1,2,4]triazolo[4,3-a]pyridin-3-amine |
|---|---|
| PubChem CID | 56697911 |
| Molecular Formula | C12H9ClN4 |
| Molecular Weight | 244.69 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | N-(4-chlorophenyl)-[1,2,4]triazolo[4,3-a]pyridin-3-amine |
| SMILES | Clc1ccc(Nc2nnc3ccccn23)cc1 |
| InChI | InChI=1S/C12H9ClN4/c13-9-4-6-10(7-5-9)14-12-16-15-11-3-1-2-8-17(11)12/h1-8H,(H,14,16) |
| InChIKey | ICFGJRGASWLMKS-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.69 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |