C19H36S — CID 126685198
(6E)-5,5,8,8-tetramethyl-4-pentyldeca-6,9-diene-1-thiol (PubChem CID 126685198) has the molecular formula C19H36S and a molecular weight of 296.56 g/mol. Its IUPAC name is (6E)-5,5,8,8-tetramethyl-4-pentyldeca-6,9-diene-1-thiol.
| Compound Name | (6E)-5,5,8,8-tetramethyl-4-pentyldeca-6,9-diene-1-thiol |
|---|---|
| PubChem CID | 126685198 |
| Molecular Formula | C19H36S |
| Molecular Weight | 296.56 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | (6E)-5,5,8,8-tetramethyl-4-pentyldeca-6,9-diene-1-thiol |
| SMILES | C=CC(C)(C)/C=C/C(C)(C)C(CCCS)CCCCC |
| InChI | InChI=1S/C19H36S/c1-7-9-10-12-17(13-11-16-20)19(5,6)15-14-18(3,4)8-2/h8,14-15,17,20H,2,7,9-13,16H2,1,3-6H3/b15-14+ |
| InChIKey | BHKKGZYCUNAKKM-CCEZHUSRSA-N |
| XLogP | 6.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.56 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|