C20H24N2O2S — CID 126687364
5-[[(3aS,6aR)-5-benzyl-5-hydroxy-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]methylsulfanyl]-1H-pyridin-2-one (PubChem CID 126687364) has the molecular formula C20H24N2O2S and a molecular weight of 356.49 g/mol. Its IUPAC name is 5-[[(3aS,6aR)-5-benzyl-5-hydroxy-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]methylsulfanyl]-1H-pyridin-2-one.
| Compound Name | 5-[[(3aS,6aR)-5-benzyl-5-hydroxy-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]methylsulfanyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 126687364 |
| Molecular Formula | C20H24N2O2S |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 5-[[(3aS,6aR)-5-benzyl-5-hydroxy-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]methylsulfanyl]-1H-pyridin-2-one |
| SMILES | O=c1ccc(SCN2C[C@@H]3CC(O)(Cc4ccccc4)C[C@@H]3C2)c[nH]1 |
| InChI | InChI=1S/C20H24N2O2S/c23-19-7-6-18(11-21-19)25-14-22-12-16-9-20(24,10-17(16)13-22)8-15-4-2-1-3-5-15/h1-7,11,16-17,24H,8-10,12-14H2,(H,21,23)/t16-,17+,20? |
| InChIKey | SLQMKQDTSZFWNS-XEWABKELSA-N |
| XLogP | 2.74 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |