C24H28N2O3 — CID 167300852
6-[1-[(3aS)-5-benzyl-5-hydroxy-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]propan-2-yl]-3H-1,3-benzoxazol-2-one (PubChem CID 167300852) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is 6-[1-[(3aS)-5-benzyl-5-hydroxy-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]propan-2-yl]-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-[1-[(3aS)-5-benzyl-5-hydroxy-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]propan-2-yl]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 167300852 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | 6-[1-[(3aS)-5-benzyl-5-hydroxy-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]propan-2-yl]-3H-1,3-benzoxazol-2-one |
| SMILES | CC(CN1CC2CC(O)(Cc3ccccc3)C[C@@H]2C1)c1ccc2[nH]c(=O)oc2c1 |
| InChI | InChI=1S/C24H28N2O3/c1-16(18-7-8-21-22(9-18)29-23(27)25-21)13-26-14-19-11-24(28,12-20(19)15-26)10-17-5-3-2-4-6-17/h2-9,16,19-20,28H,10-15H2,1H3,(H,25,27)/t16?,19-,20?,24?/m1/s1 |
| InChIKey | FXUZYPDMTRUBRL-DAMGRWPNSA-N |
| XLogP | 3.54 |
| TPSA | 69.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |