C22H26FNO — CID 126687005
(3aR,6aS)-2-[2-(3-fluorophenyl)propyl]-5-phenyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-5-ol (PubChem CID 126687005) has the molecular formula C22H26FNO and a molecular weight of 339.45 g/mol. Its IUPAC name is (3aR,6aS)-2-[2-(3-fluorophenyl)propyl]-5-phenyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-5-ol.
| Compound Name | (3aR,6aS)-2-[2-(3-fluorophenyl)propyl]-5-phenyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-5-ol |
|---|---|
| PubChem CID | 126687005 |
| Molecular Formula | C22H26FNO |
| Molecular Weight | 339.45 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | (3aR,6aS)-2-[2-(3-fluorophenyl)propyl]-5-phenyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-5-ol |
| SMILES | CC(CN1C[C@@H]2CC(O)(c3ccccc3)C[C@@H]2C1)c1cccc(F)c1 |
| InChI | InChI=1S/C22H26FNO/c1-16(17-6-5-9-21(23)10-17)13-24-14-18-11-22(25,12-19(18)15-24)20-7-3-2-4-8-20/h2-10,16,18-19,25H,11-15H2,1H3/t16?,18-,19+,22? |
| InChIKey | KONKJIZGVWGLBU-BHWSWFIUSA-N |
| XLogP | 4.16 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.45 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |