C26H34FNO — CID 126687349
(3aS,6aR)-5-(4-tert-butylphenyl)-2-[2-(3-fluorophenyl)propyl]-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-5-ol (PubChem CID 126687349) has the molecular formula C26H34FNO and a molecular weight of 395.56 g/mol. Its IUPAC name is (3aS,6aR)-5-(4-tert-butylphenyl)-2-[2-(3-fluorophenyl)propyl]-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-5-ol.
| Compound Name | (3aS,6aR)-5-(4-tert-butylphenyl)-2-[2-(3-fluorophenyl)propyl]-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-5-ol |
|---|---|
| PubChem CID | 126687349 |
| Molecular Formula | C26H34FNO |
| Molecular Weight | 395.56 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | (3aS,6aR)-5-(4-tert-butylphenyl)-2-[2-(3-fluorophenyl)propyl]-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-5-ol |
| SMILES | CC(CN1C[C@@H]2CC(O)(c3ccc(C(C)(C)C)cc3)C[C@@H]2C1)c1cccc(F)c1 |
| InChI | InChI=1S/C26H34FNO/c1-18(19-6-5-7-24(27)12-19)15-28-16-20-13-26(29,14-21(20)17-28)23-10-8-22(9-11-23)25(2,3)4/h5-12,18,20-21,29H,13-17H2,1-4H3/t18?,20-,21+,26? |
| InChIKey | FGOBEYMBIGCKCO-FOTKDGIVSA-N |
| XLogP | 5.46 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.56 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |