About CID 134951772
CID 134951772 (PubChem CID 134951772) has the molecular formula C21H20FSi
and a molecular weight of 319.48 g/mol.
Molecular Properties
| Compound Name | CID 134951772 |
| PubChem CID | 134951772 |
| Molecular Formula | C21H20FSi |
| Molecular Weight | 319.48 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | — |
| SMILES | C[C@H](C[Si](c1ccccc1)c1ccccc1)c1cccc(F)c1 |
| InChI | InChI=1S/C21H20FSi/c1-17(18-9-8-10-19(22)15-18)16-23(20-11-4-2-5-12-20)21-13-6-3-7-14-21/h2-15,17H,16H2,1H3/t17-/m1/s1 |
| InChIKey | RWHPWUNJXZQFCX-QGZVFWFLSA-N |
| XLogP | 4.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.48 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 134951772 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 134951772?
The IUPAC name of CID 134951772 (CID 134951772) is not available.
What is the SMILES notation for CID 134951772?
The canonical SMILES for CID 134951772 is C[C@H](C[Si](c1ccccc1)c1ccccc1)c1cccc(F)c1.
What is the InChIKey of CID 134951772?
The InChIKey is RWHPWUNJXZQFCX-QGZVFWFLSA-N. The full InChI is InChI=1S/C21H20FSi/c1-17(18-9-8-10-19(22)15-18)16-23(20-11-4-2-5-12-20)21-13-6-3-7-14-21/h2-15,17H,16H2,1H3/t17-/m1/s1.
What are the key properties of CID 134951772?
CID 134951772 has a molecular weight of 319.48 g/mol, XLogP of 4.24, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 134951772 is sourced from PubChem (CID 134951772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).