C22H35ClN4O3S — CID 126693789
5-chloro-2-[4-[(2S)-2-[(1-ethylsulfonylpiperidin-4-yl)methoxymethyl]but-3-enyl]piperidin-1-yl]pyrimidine (PubChem CID 126693789) has the molecular formula C22H35ClN4O3S and a molecular weight of 471.07 g/mol. Its IUPAC name is 5-chloro-2-[4-[(2S)-2-[(1-ethylsulfonylpiperidin-4-yl)methoxymethyl]but-3-enyl]piperidin-1-yl]pyrimidine.
| Compound Name | 5-chloro-2-[4-[(2S)-2-[(1-ethylsulfonylpiperidin-4-yl)methoxymethyl]but-3-enyl]piperidin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 126693789 |
| Molecular Formula | C22H35ClN4O3S |
| Molecular Weight | 471.07 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | 5-chloro-2-[4-[(2S)-2-[(1-ethylsulfonylpiperidin-4-yl)methoxymethyl]but-3-enyl]piperidin-1-yl]pyrimidine |
| SMILES | C=C[C@@H](COCC1CCN(S(=O)(=O)CC)CC1)CC1CCN(c2ncc(Cl)cn2)CC1 |
| InChI | InChI=1S/C22H35ClN4O3S/c1-3-18(16-30-17-20-7-11-27(12-8-20)31(28,29)4-2)13-19-5-9-26(10-6-19)22-24-14-21(23)15-25-22/h3,14-15,18-20H,1,4-13,16-17H2,2H3/t18-/m1/s1 |
| InChIKey | CCWKTLPVUVGSGN-GOSISDBHSA-N |
| XLogP | 3.62 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.07 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|