C25H44N4O3S — CID 126694335
5-(2-methylpropyl)-2-[4-[3-[(1-propylsulfonylpiperidin-4-yl)methoxy]propyl]piperidin-1-yl]pyrimidine (PubChem CID 126694335) has the molecular formula C25H44N4O3S and a molecular weight of 480.72 g/mol. Its IUPAC name is 5-(2-methylpropyl)-2-[4-[3-[(1-propylsulfonylpiperidin-4-yl)methoxy]propyl]piperidin-1-yl]pyrimidine.
| Compound Name | 5-(2-methylpropyl)-2-[4-[3-[(1-propylsulfonylpiperidin-4-yl)methoxy]propyl]piperidin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 126694335 |
| Molecular Formula | C25H44N4O3S |
| Molecular Weight | 480.72 g/mol |
| Exact Mass | 480.31 |
| IUPAC Name | 5-(2-methylpropyl)-2-[4-[3-[(1-propylsulfonylpiperidin-4-yl)methoxy]propyl]piperidin-1-yl]pyrimidine |
| SMILES | CCCS(=O)(=O)N1CCC(COCCCC2CCN(c3ncc(CC(C)C)cn3)CC2)CC1 |
| InChI | InChI=1S/C25H44N4O3S/c1-4-16-33(30,31)29-13-9-23(10-14-29)20-32-15-5-6-22-7-11-28(12-8-22)25-26-18-24(19-27-25)17-21(2)3/h18-19,21-23H,4-17,20H2,1-3H3 |
| InChIKey | VNWUQJJCCYPFMF-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.72 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|