C6H8N2O — CID 126695723
(2E,4E)-3-amino-5-hydroxyhexa-2,4-dienenitrile (PubChem CID 126695723) has the molecular formula C6H8N2O and a molecular weight of 124.14 g/mol. Its IUPAC name is (2E,4E)-3-amino-5-hydroxyhexa-2,4-dienenitrile.
| Compound Name | (2E,4E)-3-amino-5-hydroxyhexa-2,4-dienenitrile |
|---|---|
| PubChem CID | 126695723 |
| Molecular Formula | C6H8N2O |
| Molecular Weight | 124.14 g/mol |
| Exact Mass | 124.06 |
| IUPAC Name | (2E,4E)-3-amino-5-hydroxyhexa-2,4-dienenitrile |
| SMILES | C/C(O)=C\C(N)=C/C#N |
| InChI | InChI=1S/C6H8N2O/c1-5(9)4-6(8)2-3-7/h2,4,9H,8H2,1H3/b5-4+,6-2+ |
| InChIKey | GSBZFSNBNWDHGP-JYZMYEGWSA-N |
| XLogP | 0.81 |
| TPSA | 70.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.14 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|