C5H10N2O — CID 89161120
O-[(2Z)-4-aminopenta-2,4-dien-2-yl]hydroxylamine (PubChem CID 89161120) has the molecular formula C5H10N2O and a molecular weight of 114.15 g/mol. Its IUPAC name is O-[(2Z)-4-aminopenta-2,4-dien-2-yl]hydroxylamine.
| Compound Name | O-[(2Z)-4-aminopenta-2,4-dien-2-yl]hydroxylamine |
|---|---|
| PubChem CID | 89161120 |
| Molecular Formula | C5H10N2O |
| Molecular Weight | 114.15 g/mol |
| Exact Mass | 114.08 |
| IUPAC Name | O-[(2Z)-4-aminopenta-2,4-dien-2-yl]hydroxylamine |
| SMILES | C=C(N)/C=C(/C)ON |
| InChI | InChI=1S/C5H10N2O/c1-4(6)3-5(2)8-7/h3H,1,6-7H2,2H3/b5-3- |
| InChIKey | LRKJERDCAVJKKC-HYXAFXHYSA-N |
| XLogP | 0.25 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.15 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|