C6H11NO — CID 142106439
(3E)-4-methoxypenta-1,3-dien-2-amine (PubChem CID 142106439) has the molecular formula C6H11NO and a molecular weight of 113.16 g/mol. Its IUPAC name is (3E)-4-methoxypenta-1,3-dien-2-amine.
| Compound Name | (3E)-4-methoxypenta-1,3-dien-2-amine |
|---|---|
| PubChem CID | 142106439 |
| Molecular Formula | C6H11NO |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.08 |
| IUPAC Name | (3E)-4-methoxypenta-1,3-dien-2-amine |
| SMILES | C=C(N)/C=C(\C)OC |
| InChI | InChI=1S/C6H11NO/c1-5(7)4-6(2)8-3/h4H,1,7H2,2-3H3/b6-4+ |
| InChIKey | NSZJHLFPXRCHFN-GQCTYLIASA-N |
| XLogP | 1.01 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|