C7H11ClN2O — CID 89044529
(1E,3E)-5-chloro-1-methoxyhexa-1,3,5-triene-1,3-diamine (PubChem CID 89044529) has the molecular formula C7H11ClN2O and a molecular weight of 174.63 g/mol. Its IUPAC name is (1E,3E)-5-chloro-1-methoxyhexa-1,3,5-triene-1,3-diamine.
| Compound Name | (1E,3E)-5-chloro-1-methoxyhexa-1,3,5-triene-1,3-diamine |
|---|---|
| PubChem CID | 89044529 |
| Molecular Formula | C7H11ClN2O |
| Molecular Weight | 174.63 g/mol |
| Exact Mass | 174.06 |
| IUPAC Name | (1E,3E)-5-chloro-1-methoxyhexa-1,3,5-triene-1,3-diamine |
| SMILES | C=C(Cl)/C=C(N)\C=C(/N)OC |
| InChI | InChI=1S/C7H11ClN2O/c1-5(8)3-6(9)4-7(10)11-2/h3-4H,1,9-10H2,2H3/b6-3+,7-4+ |
| InChIKey | KGTCDURHYSETOS-XOKGJFMYSA-N |
| XLogP | 1.03 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.63 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|