C7H12ClNO — CID 166129434
(2Z,4E)-5-chloro-2-methoxyhexa-2,4-dien-3-amine (PubChem CID 166129434) has the molecular formula C7H12ClNO and a molecular weight of 161.63 g/mol. Its IUPAC name is (2Z,4E)-5-chloro-2-methoxyhexa-2,4-dien-3-amine.
| Compound Name | (2Z,4E)-5-chloro-2-methoxyhexa-2,4-dien-3-amine |
|---|---|
| PubChem CID | 166129434 |
| Molecular Formula | C7H12ClNO |
| Molecular Weight | 161.63 g/mol |
| Exact Mass | 161.06 |
| IUPAC Name | (2Z,4E)-5-chloro-2-methoxyhexa-2,4-dien-3-amine |
| SMILES | CO/C(C)=C(N)/C=C(\C)Cl |
| InChI | InChI=1S/C7H12ClNO/c1-5(8)4-7(9)6(2)10-3/h4H,9H2,1-3H3/b5-4+,7-6- |
| InChIKey | UDIFWBMIXBJFGZ-DEQVHDEQSA-N |
| XLogP | 1.97 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.63 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|