C6H10ClNO — CID 143972679
(1E,3E)-1-chloro-4-methoxypenta-1,3-dien-1-amine (PubChem CID 143972679) has the molecular formula C6H10ClNO and a molecular weight of 147.60 g/mol. Its IUPAC name is (1E,3E)-1-chloro-4-methoxypenta-1,3-dien-1-amine.
| Compound Name | (1E,3E)-1-chloro-4-methoxypenta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 143972679 |
| Molecular Formula | C6H10ClNO |
| Molecular Weight | 147.60 g/mol |
| Exact Mass | 147.05 |
| IUPAC Name | (1E,3E)-1-chloro-4-methoxypenta-1,3-dien-1-amine |
| SMILES | CO/C(C)=C/C=C(\N)Cl |
| InChI | InChI=1S/C6H10ClNO/c1-5(9-2)3-4-6(7)8/h3-4H,8H2,1-2H3/b5-3+,6-4- |
| InChIKey | KJBNPBZNPPPIPW-UZNMPDEFSA-N |
| XLogP | 1.58 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.60 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|