C8H12ClNO — CID 172622257
(3E,5Z)-5-chloro-6-methoxyhepta-1,3,5-trien-4-amine (PubChem CID 172622257) has the molecular formula C8H12ClNO and a molecular weight of 173.64 g/mol. Its IUPAC name is (3E,5Z)-5-chloro-6-methoxyhepta-1,3,5-trien-4-amine.
| Compound Name | (3E,5Z)-5-chloro-6-methoxyhepta-1,3,5-trien-4-amine |
|---|---|
| PubChem CID | 172622257 |
| Molecular Formula | C8H12ClNO |
| Molecular Weight | 173.64 g/mol |
| Exact Mass | 173.06 |
| IUPAC Name | (3E,5Z)-5-chloro-6-methoxyhepta-1,3,5-trien-4-amine |
| SMILES | C=C/C=C(N)\C(Cl)=C(/C)OC |
| InChI | InChI=1S/C8H12ClNO/c1-4-5-7(10)8(9)6(2)11-3/h4-5H,1,10H2,2-3H3/b7-5+,8-6- |
| InChIKey | SDWDRJUZAQAARR-YMBWGVAGSA-N |
| XLogP | 2.13 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.64 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|